| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-05-19 01:34:11 UTC |
|---|
| Update Date | 2016-10-28 10:01:52 UTC |
|---|
| Accession Number | CHEM004082 |
|---|
| Identification |
|---|
| Common Name | Benzoyl peroxide |
|---|
| Class | Small Molecule |
|---|
| Description | Benzoyl peroxide is a commonly used drug in topical treatments for acne.[L33249,L33264,L33269,L33299,L33314] It has been formulated as products with either a single active ingredient,[L33249,L33299] or with [erythromycin],[L33264] [clindamycin],[L33269] or [adapalene].[L33314] After administration, the peroxide bond is cleaved, allowing benzoyloxy radicals to nonspecifically interact with proteins.[A18903,A233859] This treatment decreases keratin and sebum around follicles, as well as increasing turnover of epithelial cells.[A234059,A234064,A234069]
Benzoyl peroxide, in combination with erythromycin, was granted FDA approval on 26 October 1984.[L33264] |
|---|
| Contaminant Sources | - Clean Air Act Chemicals
- Cosmetic Chemicals
- EAFUS Chemicals
- FooDB Chemicals
- HPV EPA Chemicals
- IARC Carcinogens Group 3
- OECD HPV Chemicals
- OSHA Hazardous Chemicals
- STOFF IDENT Compounds
- ToxCast & Tox21 Chemicals
|
|---|
| Contaminant Type | Not Available |
|---|
| Chemical Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| Bepio | Kegg | | Abcat 40 | HMDB | | Abcure S-40-25 | HMDB | | Acetoxyl | HMDB | | AcetOxyl 2.5 and 5 | HMDB | | Acnegel | HMDB | | Akneroxid 5 | HMDB | | Akneroxid L | HMDB | | Akneroxide L | HMDB | | Aksil 5 | HMDB | | Asidopan | HMDB | | Aztec benzoyl peroxide-70-77 | HMDB | | Aztec benzoyl peroxide-dry | HMDB | | Aztec bpo | HMDB | | Benbel c | HMDB | | Benox 50 | HMDB | | Benoxyl | HMDB | | Benoxyl (5&10) lotion | HMDB | | Benzac | HMDB | | Benzac W | HMDB | | Benzagel | HMDB | | Benzagel 10 | HMDB | | Benzaknen | HMDB | | Benzaknew | HMDB | | Benzamycin | HMDB | | Benzashave | HMDB | | Benzoic acid, peroxide | HMDB | | Benzol peroxide | HMDB | | Benzoperoxide | HMDB | | Benzoyl | HMDB | | Benzoyl peroide | HMDB | | Benzoyl peroxide (luperox(R) a70S) | HMDB | | Benzoyl peroxide (luperox(R) a75) | HMDB | | Benzoyl peroxide (luperox(R) a75fp) | HMDB | | Benzoyl peroxide (luperox(R) a98) | HMDB | | Benzoyl peroxide(usan) | HMDB | | Benzoyl peroxide, blend in dibutyl phthalate | HMDB | | Benzoyl peroxide, blend in tricresyl phosphate | HMDB | | Benzoyl peroxide, usan | HMDB | | Benzoyl superoxide | HMDB | | Benzoylperoxid | HMDB | | Benzoylperoxyde | HMDB | | BPO | HMDB | | Brevoxyl | HMDB | | Cadat bpo | HMDB | | Cadet | HMDB | | Cadet bpo-70W | HMDB | | Cadox | HMDB | | Cadox 40E | HMDB | | Cadox b | HMDB | | Cadox b 40E | HMDB | | Cadox b 50P | HMDB | | Cadox b 70W | HMDB | | Cadox b-CH 50 | HMDB | | Cadox bpo-w40 | HMDB | | Cadox BS | HMDB | | Cadox bta | HMDB | | Cadox BTW-50 | HMDB | | Chaloxyd BP 50FT | HMDB | | Clear by design | HMDB | | Clearasil antibacterial acne lotion | HMDB | | Clearasil benzoyl peroxide lotion | HMDB | | Clearasil BP acne treatment | HMDB | | Debroxide | HMDB | | Dermoxyl | HMDB | | Desanden | HMDB | | Desquam e | HMDB | | Desquam X | HMDB | | Desquam-X | HMDB | | Dibenzoylperoxid | HMDB | | Dibenzoylperoxyde | HMDB | | Diphenylglyoxal peroxide | HMDB | | Diphenylglyoxal superoxide | HMDB | | Diphenylperoxyanhydride | HMDB | | DRY and clear | HMDB | | Duresthin 5 | HMDB | | Eloxyl | HMDB | | Epi clear antiseptic lotion | HMDB | | Epi-clear | HMDB | | Florox | HMDB | | Fostex bpo | HMDB | | Garox | HMDB | | Incidol | HMDB | | Loroxide | HMDB | | Lucidol | HMDB | | Lucidol (peroxide) | HMDB | | Lucidol 50P | HMDB | | Lucidol 75fp | HMDB | | Lucidol b 50 | HMDB | | Lucidol g 20 | HMDB | | Lucidol GS | HMDB | | Lucidol KL 50 | HMDB | | Lucidol RM | HMDB | | Lucidol-70 | HMDB | | Lucidol-78 | HMDB | | Lucilite | HMDB | | Lucipal | HMDB | | Luperco | HMDB | | Luperco a | HMDB | | Luperco aa | HMDB | | Luperco ac | HMDB | | Luperco afr | HMDB | | Luperco afr-250 | HMDB | | Luperco ast | HMDB | | Luperox a98 | HMDB | | Luperox FL | HMDB | | Luzidol | HMDB | | Mixture OF dibenzoyl peroxide and calcium sulfate | HMDB | | Mixture OF dibenzoyl peroxide and calcium sulphate | HMDB | | Mytolac | HMDB | | Nayper b and bo | HMDB | | Nayper bo | HMDB | | Nericur | HMDB | | Norox BZP-250 | HMDB | | Norox BZP-C-35 | HMDB | | Novadeiox | HMDB | | Novadelox | HMDB | | NSC 675 | HMDB | | Oxy 5 | HMDB | | Oxy wash | HMDB | | Oxy-10 cover | HMDB | | Oxy-5 | HMDB | | Oxy-L | HMDB | | Oxylite | HMDB | | Panoxyl | HMDB | | Periygel | HMDB | | Perossido di benzoile | HMDB | | Peroxide, benzoyl | HMDB | | Peroxide, dibenzoyl | HMDB | | Peroxyde de benzoyle | HMDB | | Peroxyderm | HMDB | | Peroxydex | HMDB | | Persa-gel | HMDB | | Persadox | HMDB | | Phisoac BP | HMDB | | Preoxydex | HMDB | | Presadox | HMDB | | Quinolor compound | HMDB | | Resdan akne | HMDB | | Sanoxit | HMDB | | Silica hydrogel | HMDB | | Stri-dex b.p | HMDB | | Stri-dex b.p. | HMDB | | Sulfoxyl | HMDB | | Superox | HMDB | | Superox 744 | HMDB | | Superoxide, benzoyl | HMDB | | Superoxide, diphenylglyoxal | HMDB | | Thermaderm | HMDB | | Topex | HMDB | | Vanoxide | HMDB | | Xerac | HMDB | | Xerac BP | HMDB | | Xerac BP 10 | HMDB | | Xerac BP 5 | HMDB | | Dibenzoyl peroxide | HMDB |
|
|---|
| Chemical Formula | C14H10O4 |
|---|
| Average Molecular Mass | 242.227 g/mol |
|---|
| Monoisotopic Mass | 242.058 g/mol |
|---|
| CAS Registry Number | 94-36-0 |
|---|
| IUPAC Name | benzoyl benzenecarboperoxoate |
|---|
| Traditional Name | fostex |
|---|
| SMILES | O=C(OOC(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
|---|
| InChI Identifier | InChI=1S/C14H10O4/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-10H |
|---|
| InChI Key | OMPJBNCRMGITSC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as benzoyl peroxides. These are organic compounds containing two benzoyl groups O-linked to each other via a peroxide group. Their skeleton has the general formula [C6H5C(O)]2O2. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Benzenoids |
|---|
| Class | Benzene and substituted derivatives |
|---|
| Sub Class | Benzoyl peroxides |
|---|
| Direct Parent | Benzoyl peroxides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Benzoyl peroxide
- Peroxybenzoate
- Benzoic acid or derivatives
- Benzoyl
- Dicarboxylic acid or derivatives
- Peroxycarboxylic acid or derivatives
- Carboxylic acid salt
- Carboxylic acid derivative
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Organic salt
- Organooxygen compound
- Aromatic homomonocyclic compound
|
|---|
| Molecular Framework | Aromatic homomonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Biological Properties |
|---|
| Status | Detected and Not Quantified |
|---|
| Origin | Not Available |
|---|
| Cellular Locations | Not Available |
|---|
| Biofluid Locations | Not Available |
|---|
| Tissue Locations | Not Available |
|---|
| Pathways | Not Available |
|---|
| Applications | Not Available |
|---|
| Biological Roles | Not Available |
|---|
| Chemical Roles | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Appearance | Not Available |
|---|
| Experimental Properties | | Property | Value |
|---|
| Melting Point | Not Available | | Boiling Point | Not Available | | Solubility | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | | Spectrum Type | Description | Splash Key | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - GC-MS (Non-derivatized) - 70eV, Positive | splash10-0a4i-0900000000-423d9df6ef4f9ce5a079 | Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - GC-MS (Non-derivatized) - 70eV, Positive | Not Available | Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - GC-MS (Non-derivatized) - 70eV, Positive | Not Available | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 10V, Positive | splash10-0006-0390000000-50998e66fa2f7bef20e1 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 20V, Positive | splash10-0a4i-0920000000-e7246fd3375ad32b63a9 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 40V, Positive | splash10-0a4i-4900000000-584b69634dd12fe901d3 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 10V, Negative | splash10-0006-0090000000-31279cde2ca79ff16285 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 20V, Negative | splash10-0006-0290000000-9bcc1591e9874715a701 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 40V, Negative | splash10-0udi-3930000000-ac2e3837cbd47bd6015d | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 10V, Positive | splash10-0a4l-0980000000-c0b8b681a6b292a33c25 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 20V, Positive | splash10-0a4i-0900000000-488d41e3a0b2e5a9eb49 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 40V, Positive | splash10-0a4i-2900000000-2602e3f446e8009ad5fd | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 10V, Negative | splash10-0006-0090000000-871b46014990fc059dac | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 20V, Negative | splash10-0006-0090000000-c13c84561286f2b25014 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 40V, Negative | splash10-004i-9000000000-f83e28014dc1944fb49a | Spectrum |
|
|---|
| Toxicity Profile |
|---|
| Route of Exposure | Not Available |
|---|
| Mechanism of Toxicity | Not Available |
|---|
| Metabolism | Not Available |
|---|
| Toxicity Values | Not Available |
|---|
| Lethal Dose | Not Available |
|---|
| Carcinogenicity (IARC Classification) | Not Available |
|---|
| Uses/Sources | Not Available |
|---|
| Minimum Risk Level | Not Available |
|---|
| Health Effects | Not Available |
|---|
| Symptoms | Not Available |
|---|
| Treatment | Not Available |
|---|
| Concentrations |
|---|
| Not Available |
|---|
| External Links |
|---|
| DrugBank ID | DB09096 |
|---|
| HMDB ID | HMDB0032040 |
|---|
| FooDB ID | FDB008743 |
|---|
| Phenol Explorer ID | Not Available |
|---|
| KNApSAcK ID | Not Available |
|---|
| BiGG ID | Not Available |
|---|
| BioCyc ID | Not Available |
|---|
| METLIN ID | Not Available |
|---|
| PDB ID | Not Available |
|---|
| Wikipedia Link | Benzoyl peroxide |
|---|
| Chemspider ID | 6919 |
|---|
| ChEBI ID | Not Available |
|---|
| PubChem Compound ID | 7187 |
|---|
| Kegg Compound ID | C19346 |
|---|
| YMDB ID | Not Available |
|---|
| ECMDB ID | Not Available |
|---|
| References |
|---|
| Synthesis Reference | Not Available |
|---|
| MSDS | Not Available |
|---|
| General References | | 1. Welch SL: Oral toxicity of topical preparations. Vet Clin North Am Small Anim Pract. 2002 Mar;32(2):443-53, vii. | | 2. Nacht S, Gans EH, McGinley KJ, Kligman AM: Comparative activity of benzoyl peroxide and hexachlorophene. In vivo studies against propionibacterium acnes in humans. Arch Dermatol. 1983 Jul;119(7):577-9. | | 3. Angelini G, Vena GA, Meneghini CL: Allergic contact dermatitis to some medicaments. Contact Dermatitis. 1985 May;12(5):263-9. | | 4. Hegemann L, Toso SM, Kitay K, Webster GF: Anti-inflammatory actions of benzoyl peroxide: effects on the generation of reactive oxygen species by leucocytes and the activity of protein kinase C and calmodulin. Br J Dermatol. 1994 May;130(5):569-75. | | 5. Dreno B: Topical antibacterial therapy for acne vulgaris. Drugs. 2004;64(21):2389-97. | | 6. Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC. |
|
|---|