Mrv1652306061823112D 12 11 0 0 0 0 999 V2000 -4.1071 0.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3927 0.5687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6782 0.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9749 0.5576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2604 0.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5348 0.5687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1797 0.1562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8942 0.5687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6086 0.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3231 0.5687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0376 0.1562 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2493 -0.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 5 12 1 0 0 0 0 M STY 3 1 SRU 2 SRU 3 SRU M SCN 1 1 HT M SAL 1 3 2 3 4 M SDI 1 4 -1.6557 0.9455 -1.6557 -0.0445 M SDI 1 4 -3.6337 -0.0445 -3.6337 0.9455 M SBL 1 2 1 4 M SMT 1 a M SCN 1 2 HT M SAL 2 3 8 9 10 M SDI 2 4 2.6311 0.9455 2.6311 -0.0892 M SDI 2 4 0.6978 -0.0334 0.6978 0.9566 M SBL 2 2 7 10 M SMT 2 a M SCN 1 3 HT M SAL 3 4 5 12 6 7 M SDI 3 4 0.4736 0.9288 0.4736 -0.9312 M SDI 3 4 -1.4457 -0.9682 -1.4457 1.0151 M SBL 3 2 4 7 M SMT 3 b M END > CHEM003652 > chemdb > [H]OCCOCC(C)OCCC > InChI=1S/C8H18O3/c1-3-5-11-8(2)7-10-6-4-9/h8-9H,3-7H2,1-2H3 > CTKXFMQHOOWWEB-UHFFFAOYSA-N > (C3H6O)b(C2H4O)a(C2H4O)aCH4 > 0 > 0 > 0.62 > -0.72 > 0 > 3.13e+01 g/l > T3D4694 > Ethylene oxide/propylene oxide copolymer > 9003-11-6 > 1,2-Propyleneglycol, ethoxylated and propoxylated; Adeka 25R1; Adeka 25R2; Adeka L 61; Adeka Pluronic F 108; Antarox 17R4; Antarox 25R2; Antarox B 25; Antarox F 108; Antarox F 68; Antarox F 88; Antarox F 88FL; Antarox L 61; Antarox L 72; Antarox P 104; Antarox P 84; Antarox SC 138; Arco Polyol R 2633; Arcol E 351; BASF-L 101; Berol TVM 370; Bloat guard; Block polyethylene-polypropylene glycol; Block polyoxyethylene-polyoxypropylene; Breox BL 19-10; Cirrasol aln-WS; Crisvon Assistor SD 14; D 500 (Polyglycol); Daltocel F 460; Dehypon KE 3557; Detalan; Emkalyx EP 64; Emkalyx L 101; Emkalyx L101; Empilan P 7068; Emulgen PP 230; Epan U 108; Ethylene glycol-propylene glycol block copolymer; Ethylene glycol-propylene glycol polymer; Ethylene oxide, propylene oxide block polymer; Ethylene oxide-propylene oxide block polymer; Ethylene oxide-propylene oxide copolymer; Genapol PF 10; Glycols, polyethylene-polypropylene; Glycols, polyethylenepolypropylene; Hydrowet; Laprol 1502; Magcyl; Meroxapol 105; Methyloxirane polymer with oxirane block; Methyloxirane-oxirane copolymer; Methyloxirane-oxirane polymer; Monolan 8000E80; Monolan PB; Newpol PE-88; Niax LG 56; Nissan Pronon 201; Nixolen SL 19; Oligoether L-1502-2-30; Oxirane, 2-methyl-, polymer with oxirane; Oxirane, methyl-, polymer with oxirane; Oxirane, methyl-, polymer with oxirane, block; Oxirane, polymer with methyloxirane; Oxirane-methyloxirane polymer; Oxyethylene oxypropylene polymer; PEG/PPG-125/30 Copolymer; Plonon 201; Plonon 204; Pluracare; Pluronic; Pluronic 10R8; Pluronic 31R2; Pluronic C 121; Pluronic f; Pluronic F 108; Pluronic F 125; Pluronic F 127; Pluronic F 38; Pluronic F 68; Pluronic F 68LF; Pluronic F 87; Pluronic F 88; Pluronic F 98; Pluronic F-127; Pluronic F-68; Pluronic F108; Pluronic F127; Pluronic F68; Pluronic F77; Pluronic F86; Pluronic F87; Pluronic F87-A7850; Pluronic F88; Pluronic L; Pluronic L 101; Pluronic L 121; Pluronic L 122; Pluronic L 24; Pluronic L 31; Pluronic L 35; Pluronic L 44; Pluronic L 61; Pluronic L 62; Pluronic L 64; Pluronic L 68; Pluronic L 92; Pluronic L-101; Pluronic L-81; Pluronic l44; Pluronic L62; Pluronic l62(mw 2500); Pluronic L64; Pluronic l64(mw 2900); Pluronic p; Pluronic P 104; Pluronic P 75; Pluronic P 85; Pluronic P-65; Pluronic P-75; Pluronic P103; Pluronic P104; Pluronic P105; Pluronic P123; Pluronic P65; Pluronic P84; Pluronic P85; Pluronic-68; Poloxalene; Poloxalene 2930; Poloxalene L64; Poloxalene(usan); Poloxalkol; Poloxamer; Poloxamer (NF); Poloxamer 101; Poloxamer 108; Poloxamer 182LF; Poloxamer 182LF(USAN); Poloxamer 188; Poloxamer 188(USAN); Poloxamer 331; Poloxamer 331(USAN); Poloxamer 407; Poloxamer-188; Poly(ethylene oxide-co-propylene oxide); Poly(mixed ethylene, propylene)glycol; Poly(oxyethylene)-poly(oxypropylene) glycol; Poly(oxyethylene)-poly(oxypropylene) polymer; Poly(propylene oxide-ethylene oxide); Polyethylene glycol, propoxylated; Polyethylene oxide-polypropylene oxide; Polyethylene oxide-polypropylene oxide copolymer; Polyethylene-Pluronic L-62LF; Polyethylene-polypropylene glycol; Polykol; Polylon 13-5; Polyoxamer 108; Polyoxyethylenated poly(oxypropylene); Polyoxyethylene - polyoxypropylene block copolymer; Polyoxyethylene - polyoxypropylene copolymer; Polyoxyethylene polyoxypropylene; Polyoxyethylene polyoxypropylene polyoxyethylene polymer; Polyoxyethylene-oxy-propylene; Polyoxyethylene-polyoxypropylene; Polyoxyethylene-polyoxypropylene polymer; Polyoxypropylene-polyoxyethylene block copolymer; Polypropoxylated, polyethoxylated propylene glycol; Polypropylene glycol, ethoxylated; Polypropylene glycol-ethylene oxide copolymer; PPG Diol 3000EO; Proksanol; Pronon; Pronon 102; Pronon 104; Pronon 201; Pronon 204; Pronon 208; Propane-1,2-diol, ethoxylated, propoxylated; Propylen M 12; Propylene glycol, propylene oxide, ethylene oxide polymer; Propylene oxide ethylene oxide block polymer; Propylene oxide-ethylene oxide copolymer; Propylene oxide-ethylene oxide polymer; Proxanol; Proxanol 158; Proxanol 228; Proxanol Tsl-3; Regulaid; Rokopol 16P; Rokopol 30P; Rokopol 30P9; Slovanik; Slovanik 630; Slovanik 660; Slovanik M-640; Supronic B 75; Supronic E 400; Synperonic PE 30/40; Tergetol; Tergitol; Tergitol monionic XH; Tergitol nonionic XH; Tergitol XH; Tergitol XH (nonionic); Teric PE 61; Teric PE 62; Teric PE40; Teric PE60; Teric PE70; Thanol E 4003; Therabloat; Unilube 50MB168X; Unilube 50MB26X; Velvetol OE 2NT1; Voranol P 2001; Wyandotte 7135 > Food Toxin; Metabolite; Household Toxin; Synthetic Compound; Food Additive $$$$