4706 Bromomethyl ethyl ketone Bromomethyl ethyl ketone is a lachrymatory agent. It produces immediate pain to the eyes and irritate mucous membranes. This compound belongs to the class of organic compounds known as organobromides. These are compounds containing a chemical bond between a carbon atom and a bromine atom. 816-40-0 13156 C4H7BrO Pale yellow liquid. 145°C No indication of carcinogenicity to humans (not listed by IARC). 2014-09-08T02:41:04Z 2026-04-04T14:12:06Z true CCC(=O)CBr C4H7BrO InChI=1S/C4H7BrO/c1-2-4(6)3-5/h2-3H2,1H3 CCXQVBSQUQCEEO-UHFFFAOYSA-N 151.002 149.968027493 Exogenous Liquid 12604 CHEM003610 DTXSID00231216 17.07 28.558400000000002 11.39119249419421 2 1 0 17.69130760580997 -7.5563153762077775 0 0 1.11 -1.08 1.25e+01 g/l