3804 Aurovertin B Aurovertin B is a mycotoxin and antibiotic produced by the fungus Calcarisporium arbuscula. It is known for its ability to inhibit oxidative phosphorylation. (A3002, A3032) 55350-03-3 6441012 C25H32O8 White powder. Oral, dermal, inhalation, and parenteral (contaminated drugs). (A3101) Aurovertins are a mixed, noncompetitive inhibitors of both ATP hydrolysis and synthesis. They do this by inhibiting the proton-pumping F1F0-ATP synthase by binding to beta-subunits in its F1 catalytic sector. F1F0-ATP synthase is responsible for the terminal step of oxidative phosphorylation. Each ATP synthase complex has three beta subunits, and aurovertins are believed to bind with varying affinity to two subunits on sites in a cleft between the nucleotide-binding and C-terminal domains, thus preventing closure of the catalytic interfaces necessary for the cyclic interconversion of catalytic sites. (A3032, A3033, A3034) No indication of carcinogenicity to humans (not listed by IARC). Aurovertin B is a mycotoxin and antibiotic produced by the fungus Calcarisporium arbuscula. (A3002) 2010-05-12T17:30:02Z 2026-04-05T13:12:47Z DB07394 true [H]/C(=C(/[H])\C(\[H])=C(/[H])C1=C(C)C(OC)=CC(=O)O1)/C(/[H])=C(\[H])C1OC2(C)C(CC)OC(C)(C2OC(C)=O)C1O C25H32O8 InChI=1S/C25H32O8/c1-7-20-24(4)23(30-16(3)26)25(5,33-20)22(28)18(32-24)13-11-9-8-10-12-17-15(2)19(29-6)14-21(27)31-17/h8-14,18,20,22-23,28H,7H2,1-6H3/b9-8+,12-10+,13-11+ QXCOFYWOWZJFEA-YIDQAKLOSA-N 460.523 460.20971799 Exogenous Solid CHEM002718 NS00071822 100.52000000000002 125.50259999999999 50.466648172042156 8 6 1 12.9124340730191 -3.7119013364614455 0 3 4.02 -4.62 1.10e-02 g/l